![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
10,000 Things |
20-Apr-2018 16:20 |
- |
|
|
64 Stitches |
20-Apr-2018 16:20 |
- |
|
|
AA-CHINO |
20-Apr-2018 16:20 |
- |
|
|
Alfa Romeo in Julija |
20-Apr-2018 16:20 |
- |
|
|
Algor Mortis |
20-Apr-2018 16:20 |
- |
|
|
Allos |
20-Apr-2018 16:20 |
- |
|
|
Amateur Transplants |
20-Apr-2018 16:20 |
- |
|
|
American Acquarium |
20-Apr-2018 16:20 |
- |
|
|
American Diesel |
20-Apr-2018 16:20 |
- |
|
|
Andrew Deutsch & Thomas Moore |
20-Apr-2018 16:20 |
- |
|
|
Andy McGann & Paul Brady |
20-Apr-2018 16:20 |
- |
|
|
Angeline |
20-Apr-2018 16:20 |
- |
|
|
Anna LaCazio |
20-Apr-2018 16:20 |
- |
|
|
Anthony Braxton Quintet |
20-Apr-2018 16:20 |
- |
|
|
Antonín Dvořák; Prague Radio Symphony Orchestra, Vladimír Válek |
20-Apr-2018 16:20 |
- |
|
|
Anvil of Doom |
20-Apr-2018 16:20 |
- |
|
|
Apati |
20-Apr-2018 16:20 |
- |
|
|
Arik Rudich |
20-Apr-2018 16:20 |
- |
|
|
Assimilation |
20-Apr-2018 16:20 |
- |
|
|
Beethoven; San Francisco Symphony, Michael Tilson Thomas, Emanuel Ax |
20-Apr-2018 16:20 |
- |
|
|
Ben Thornewill |
20-Apr-2018 16:20 |
- |
|
|
Bernard Duguay |
20-Apr-2018 16:20 |
- |
|
|
Big Top Circus Band ⁄ Herbie Head |
20-Apr-2018 16:20 |
- |
|
|
Bill Bruford ⁄ Michiel Borstlap |
20-Apr-2018 16:20 |
- |
|
|
Birddie Goonatic |
20-Apr-2018 16:20 |
- |
|
|
Birth |
20-Apr-2018 16:20 |
- |
|
|
Blitzkrieg (Blitz) |
20-Apr-2018 16:20 |
- |
|
|
Blood Tears |
20-Apr-2018 16:20 |
- |
|
|
Blue Sky Archives |
20-Apr-2018 16:20 |
- |
|
|
Bob O'Clock |
20-Apr-2018 16:20 |
- |
|
|
Bonnie St. Claire & Unit Gloria |
20-Apr-2018 16:20 |
- |
|
|
Boris |
20-Apr-2018 16:20 |
- |
|
|
Brian Setzer with special guest Gary Setzer |
20-Apr-2018 16:20 |
- |
|
|
Brighter Death Now |
20-Apr-2018 16:20 |
- |
|
|
Brooke Allison |
20-Apr-2018 16:20 |
- |
|
|
Butterflies On Strings |
20-Apr-2018 16:20 |
- |
|
|
CH Straatmann |
20-Apr-2018 16:20 |
- |
|
|
Café Jacques |
20-Apr-2018 16:20 |
- |
|
|
Charlie Lucas Band |
20-Apr-2018 16:20 |
- |
|
|
Chemical Synthesis |
20-Apr-2018 16:20 |
- |
|
|
Chris Potter Quartet |
20-Apr-2018 16:20 |
- |
|
|
Christian Bland & The Revelators |
20-Apr-2018 16:20 |
- |
|
|
Circus of Damnation |
20-Apr-2018 16:20 |
- |
|
|
Collie ⁄⁄⁄⁄ Electric |
20-Apr-2018 16:20 |
- |
|
|
Cool John Ferguson |
20-Apr-2018 16:20 |
- |
|
|
Crucifix |
20-Apr-2018 16:20 |
- |
|
|
DANCE☆MAN |
20-Apr-2018 16:20 |
- |
|
|
DJ Clubstar |
20-Apr-2018 16:20 |
- |
|
|
DOLL$BOXX |
20-Apr-2018 16:20 |
- |
|
|
Daniel B. Prothèse |
20-Apr-2018 16:20 |
- |
|
|
Deadsy |
20-Apr-2018 16:20 |
- |
|
|
Death On⁄Off |
20-Apr-2018 16:20 |
- |
|
|
Death Tothe |
20-Apr-2018 16:20 |
- |
|
|
Delius, Elgar; Villiers Quartet |
20-Apr-2018 16:20 |
- |
|
|
Delta Funktionen |
20-Apr-2018 16:20 |
- |
|
|
Dexter |
20-Apr-2018 16:20 |
- |
|
|
Diane Jarvi |
20-Apr-2018 16:20 |
- |
|
|
Die Alten Böcke |
20-Apr-2018 16:20 |
- |
|
|
Dig (Directions in Groove) |
20-Apr-2018 16:20 |
- |
|
|
Dog Eat Dog |
20-Apr-2018 16:20 |
- |
|
|
Doug Supernaw |
20-Apr-2018 16:20 |
- |
|
|
Dragonbound |
20-Apr-2018 16:20 |
- |
|
|
Dreadful Children |
20-Apr-2018 16:20 |
- |
|
|
Driven to the Verge |
20-Apr-2018 16:20 |
- |
|
|
Eden Circus |
20-Apr-2018 16:20 |
- |
|
|
Eduardo Lages |
20-Apr-2018 16:20 |
- |
|
|
Elizabeth Fraser |
20-Apr-2018 16:20 |
- |
|
|
Elusive |
20-Apr-2018 16:20 |
- |
|
|
Emmanuel Brun |
20-Apr-2018 16:20 |
- |
|
|
Enrico Intra |
20-Apr-2018 16:20 |
- |
|
|
Enter VI |
20-Apr-2018 16:20 |
- |
|
|
Expressway Yo-Yo Dieting |
20-Apr-2018 16:20 |
- |
|
|
FATHR^ |
20-Apr-2018 16:20 |
- |
|
|
FDISK |
20-Apr-2018 16:20 |
- |
|
|
Fady One |
20-Apr-2018 16:20 |
- |
|
|
Farfield |
20-Apr-2018 16:20 |
- |
|
|
Flowers in the Dustbin |
20-Apr-2018 16:20 |
- |
|
|
Forrest Avery & Eric Andrew |
20-Apr-2018 16:20 |
- |
|
|
Fourth of July |
20-Apr-2018 16:20 |
- |
|
|
Freakwater |
20-Apr-2018 16:20 |
- |
|
|
Frenic |
20-Apr-2018 16:20 |
- |
|
|
Gangstar Beat |
20-Apr-2018 16:20 |
- |
|
|
Gasp |
20-Apr-2018 16:20 |
- |
|
|
Gebroeders Brouwer |
20-Apr-2018 16:20 |
- |
|
|
Goat Vulva |
20-Apr-2018 16:20 |
- |
|
|
Grant |
20-Apr-2018 16:20 |
- |
|
|
Guitarthing |
20-Apr-2018 16:20 |
- |
|
|
Her Fatal Flaw |
20-Apr-2018 16:20 |
- |
|
|
Hey Romeo |
20-Apr-2018 16:20 |
- |
|
|
Hotel Bossa Nova |
20-Apr-2018 16:20 |
- |
|
|
Ian Martin |
20-Apr-2018 16:20 |
- |
|
|
Incendio |
20-Apr-2018 16:20 |
- |
|
|
Ivo Deutschmann |
20-Apr-2018 16:20 |
- |
|
|
J.R.R. Tolkien read by J.R.R. Tolkien and Christopher Tolkien |
20-Apr-2018 16:20 |
- |
|
|
Jack Purvis and His Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Janáček, Martinů; Emerson String Quartet |
20-Apr-2018 16:20 |
- |
|
|
Jason Corder |
20-Apr-2018 16:20 |
- |
|
|
Jedi Knights |
20-Apr-2018 16:20 |
- |
|
|
Jennifer Lopez featuring LL Cool J |
20-Apr-2018 16:20 |
- |
|
|
Jesse & Joy |
20-Apr-2018 16:20 |
- |
|
|
Joanna Rzyczniok |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach, George Frideric Handel, Alessandro Marcello: John Williams |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach; Choir of King’s College, Cambridge, Stephen Cleobury, James Gilchrist, Neal Davies,Academy of Ancient Music |
20-Apr-2018 16:20 |
- |
|
|
John ME |
20-Apr-2018 16:20 |
- |
|
|
Judy Collins & Ernie Troost |
20-Apr-2018 16:20 |
- |
|
|
Kamisshake |
20-Apr-2018 16:20 |
- |
|
|
Kaori Ohkoshi, Hiroshi Usami, Michio Okamiya |
20-Apr-2018 16:20 |
- |
|
|
Karan Casey & Friends |
20-Apr-2018 16:20 |
- |
|
|
Kate Royal,Academy of St Martin in the Fields,Edward Gardner |
20-Apr-2018 16:20 |
- |
|
|
Kazumoto Endo ⁄ Crack Fierce |
20-Apr-2018 16:20 |
- |
|
|
Keak da Sneak Presents A-One & Lil Rue |
20-Apr-2018 16:20 |
- |
|
|
Kebacid |
20-Apr-2018 16:20 |
- |
|
|
Kelan Phil Cohran and Legacy |
20-Apr-2018 16:20 |
- |
|
|
Ken Ishii |
20-Apr-2018 16:20 |
- |
|
|
Kerrie Roberts |
20-Apr-2018 16:20 |
- |
|
|
Kovlo |
20-Apr-2018 16:20 |
- |
|
|
Krs. |
20-Apr-2018 16:20 |
- |
|
|
Kylie & Thomas Grayston |
20-Apr-2018 16:20 |
- |
|
|
LA Riots |
20-Apr-2018 16:20 |
- |
|
|
Lazybone |
20-Apr-2018 16:20 |
- |
|
|
Lina Allemano Four |
20-Apr-2018 16:20 |
- |
|
|
Long Desert Cowboy |
20-Apr-2018 16:20 |
- |
|
|
Los Del Sur |
20-Apr-2018 16:20 |
- |
|
|
Los Tones |
20-Apr-2018 16:20 |
- |
|
|
Loudspeaker |
20-Apr-2018 16:20 |
- |
|
|
Lovecraft's Adjectives |
20-Apr-2018 16:20 |
- |
|
|
Lovedrug |
20-Apr-2018 16:20 |
- |
|
|
Lucien Johnson |
20-Apr-2018 16:20 |
- |
|
|
Lucius Banda and the Zembani Band |
20-Apr-2018 16:20 |
- |
|
|
Ludwig van Beethoven; Josef Krips, London Symphony Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Major Maker |
20-Apr-2018 16:20 |
- |
|
|
Marie Hines |
20-Apr-2018 16:20 |
- |
|
|
Mark John Hariman |
20-Apr-2018 16:20 |
- |
|
|
Markey |
20-Apr-2018 16:20 |
- |
|
|
Mau Maus |
20-Apr-2018 16:20 |
- |
|
|
Maurice Ravel; Minoru Nojima |
20-Apr-2018 16:20 |
- |
|
|
Max Bruch; Antje Weithaas, NDR Radiophilharmonie, Hermann Bäumer |
20-Apr-2018 16:20 |
- |
|
|
Max Elto |
20-Apr-2018 16:20 |
- |
|
|
Memory Dean |
20-Apr-2018 16:20 |
- |
|
|
Merit |
20-Apr-2018 16:20 |
- |
|
|
Mimi Coertse |
20-Apr-2018 16:20 |
- |
|
|
Moderately Messy |
20-Apr-2018 16:20 |
- |
|
|
Monkey Biz |
20-Apr-2018 16:20 |
- |
|
|
Moritz von Pein |
20-Apr-2018 16:20 |
- |
|
|
Morte Macabre |
20-Apr-2018 16:20 |
- |
|
|
Naastrand |
20-Apr-2018 16:20 |
- |
|
|
Nabarlek |
20-Apr-2018 16:20 |
- |
|
|
Nachtluft |
20-Apr-2018 16:20 |
- |
|
|
New Composers |
20-Apr-2018 16:20 |
- |
|
|
Nic Raine & Klassik Radio Pops |
20-Apr-2018 16:20 |
- |
|
|
Nkisi |
20-Apr-2018 16:20 |
- |
|
|
O'Donel Levy |
20-Apr-2018 16:20 |
- |
|
|
Oakham School, David Woodcock |
20-Apr-2018 16:20 |
- |
|
|
Omar Romero |
20-Apr-2018 16:20 |
- |
|
|
Onset of Serious Problems |
20-Apr-2018 16:20 |
- |
|
|
Oonah & Bonas |
20-Apr-2018 16:20 |
- |
|
|
Open Road |
20-Apr-2018 16:20 |
- |
|
|
Ouderkerk Kaffers |
20-Apr-2018 16:20 |
- |
|
|
PALA$$ |
20-Apr-2018 16:20 |
- |
|
|
Pablo Campos Trio |
20-Apr-2018 16:20 |
- |
|
|
Panic DHH |
20-Apr-2018 16:20 |
- |
|
|
Paper Trails |
20-Apr-2018 16:20 |
- |
|
|
Pathogen |
20-Apr-2018 16:20 |
- |
|
|
Petronel Baard |
20-Apr-2018 16:20 |
- |
|
|
Poire_z & Phil Minton |
20-Apr-2018 16:20 |
- |
|
|
President Gas |
20-Apr-2018 16:20 |
- |
|
|
Quinzy |
20-Apr-2018 16:20 |
- |
|
|
R.Alphonso Meets Mute Beat |
20-Apr-2018 16:20 |
- |
|
|
Ra |
20-Apr-2018 16:20 |
- |
|
|
Rage Brigade |
20-Apr-2018 16:20 |
- |
|
|
Randall Wicomb |
20-Apr-2018 16:20 |
- |
|
|
Rekta feat. RBX |
20-Apr-2018 16:20 |
- |
|
|
Rev. Columbus Mann |
20-Apr-2018 16:20 |
- |
|
|
Rich Matteson |
20-Apr-2018 16:20 |
- |
|
|
Rina Hugo |
20-Apr-2018 16:20 |
- |
|
|
Ritual Aesthetic |
20-Apr-2018 16:20 |
- |
|
|
Rob Heron & The Tea Pad Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Rob Rock |
20-Apr-2018 16:20 |
- |
|
|
Rock Master Scott & The Dynamic 3 |
20-Apr-2018 16:20 |
- |
|
|
Ronan Browne |
20-Apr-2018 16:20 |
- |
|
|
Rossanna Decelso |
20-Apr-2018 16:20 |
- |
|
|
Roveena |
20-Apr-2018 16:20 |
- |
|
|
Roy Eldridge with The Gene Krupa Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Rya |
20-Apr-2018 16:20 |
- |
|
|
SAP BIG BAND |
20-Apr-2018 16:20 |
- |
|
|
Sacaulait |
20-Apr-2018 16:20 |
- |
|
|
Saint‐Saëns; Natalie Clein, BBC Scottish Symphony Orchestra, Andrew Manze |
20-Apr-2018 16:20 |
- |
|
|
Scott Sebring |
20-Apr-2018 16:20 |
- |
|
|
Search the City |
20-Apr-2018 16:20 |
- |
|
|
Seiva Bruta |
20-Apr-2018 16:20 |
- |
|
|
Serena Joy |
20-Apr-2018 16:20 |
- |
|
|
SertOne |
20-Apr-2018 16:20 |
- |
|
|
Seven That Spells |
20-Apr-2018 16:20 |
- |
|
|
Shafqat Ali Khan |
20-Apr-2018 16:20 |
- |
|
|
Simon Batten |
20-Apr-2018 16:20 |
- |
|
|
Simon Landa |
20-Apr-2018 16:20 |
- |
|
|
Sirkus Eliassen & Ben Kinx |
20-Apr-2018 16:20 |
- |
|
|
Sitric |
20-Apr-2018 16:20 |
- |
|
|
Sometime The Wolf. |
20-Apr-2018 16:20 |
- |
|
|
Sophie & Ives |
20-Apr-2018 16:20 |
- |
|
|
Southern Pacific |
20-Apr-2018 16:20 |
- |
|
|
Spell |
20-Apr-2018 16:20 |
- |
|
|
Spendel⁄Rössler⁄Goos |
20-Apr-2018 16:20 |
- |
|
|
Stephen Scott |
20-Apr-2018 16:20 |
- |
|
|
Stone & Snow |
20-Apr-2018 16:20 |
- |
|
|
Stuntmasterz |
20-Apr-2018 16:20 |
- |
|
|
Sumerian Droids |
20-Apr-2018 16:20 |
- |
|
|
Supergroove Records |
20-Apr-2018 16:20 |
- |
|
|
Sweet Lizard Illtet |
20-Apr-2018 16:20 |
- |
|
|
Sycophant |
20-Apr-2018 16:20 |
- |
|
|
Sylvia 55 |
20-Apr-2018 16:20 |
- |
|
|
Szakcsi |
20-Apr-2018 16:20 |
- |
|
|
The Blue Boy |
20-Apr-2018 16:20 |
- |
|
|
The Children of St Mary's Primary School |
20-Apr-2018 16:20 |
- |
|
|
The Citizens |
20-Apr-2018 16:20 |
- |
|
|
The Drastics |
20-Apr-2018 16:20 |
- |
|
|
The Flood |
20-Apr-2018 16:20 |
- |
|
|
The Fureys & Davey Arthur |
20-Apr-2018 16:20 |
- |
|
|
The Humans |
20-Apr-2018 16:20 |
- |
|
|
The Living Souls |
20-Apr-2018 16:20 |
- |
|
|
The Nothing |
20-Apr-2018 16:20 |
- |
|
|
The Phantoms |
20-Apr-2018 16:20 |
- |
|
|
The Rotten Duck |
20-Apr-2018 16:20 |
- |
|
|
The Stattmatratzen |
20-Apr-2018 16:20 |
- |
|
|
The Teddybears |
20-Apr-2018 16:20 |
- |
|
|
Tim Dinkins |
20-Apr-2018 16:20 |
- |
|
|
Tinchy Stryder feat. N-Dubz |
20-Apr-2018 16:20 |
- |
|
|
Tiësto feat.BT |
20-Apr-2018 16:20 |
- |
|
|
Tom Wax & Jan Jacarta |
20-Apr-2018 16:20 |
- |
|
|
Totennacht |
20-Apr-2018 16:20 |
- |
|
|
Trickster |
20-Apr-2018 16:20 |
- |
|
|
Ullyr |
20-Apr-2018 16:20 |
- |
|
|
Under The Number |
20-Apr-2018 16:20 |
- |
|
|
Wax Poetic Featuring Otto |
20-Apr-2018 16:20 |
- |
|
|
Wayne Jackson |
20-Apr-2018 16:20 |
- |
|
|
Worth Dying For |
20-Apr-2018 16:20 |
- |
|
|
Yozephine |
20-Apr-2018 16:20 |
- |
|
|
Ysgol Sul |
20-Apr-2018 16:20 |
- |
|
|
Yukmouth & Killa Klump |
20-Apr-2018 16:20 |
- |
|
|
Zander Zon |
20-Apr-2018 16:20 |
- |
|
|
duumu |
20-Apr-2018 16:20 |
- |
|
|
ex' n'hopp |
20-Apr-2018 16:20 |
- |
|
|
fetița mea mica |
20-Apr-2018 16:20 |
- |
|
|
pink mink |
20-Apr-2018 16:20 |
- |
|
|
Р. В. С. Н. |
20-Apr-2018 16:20 |
- |
|
|
ふぇのたす |
20-Apr-2018 16:20 |
- |
|
|
太田美知彦 |
20-Apr-2018 16:20 |
- |
|
|
宍戸留美 |
20-Apr-2018 16:20 |
- |
|
|
熊谷幸子 |
20-Apr-2018 16:20 |
- |
|
|
爽 |
20-Apr-2018 16:20 |
- |
|
|
|---|