![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
 |
Parent Directory |
|
- |
|
 |
10,000 Things |
20-Apr-2018 16:20 |
- |
|
 |
64 Stitches |
20-Apr-2018 16:20 |
- |
|
 |
AA-CHINO |
20-Apr-2018 16:20 |
- |
|
 |
Alfa Romeo in Julija |
20-Apr-2018 16:20 |
- |
|
 |
Algor Mortis |
20-Apr-2018 16:20 |
- |
|
 |
Allos |
20-Apr-2018 16:20 |
- |
|
 |
Amateur Transplants |
20-Apr-2018 16:20 |
- |
|
 |
American Acquarium |
20-Apr-2018 16:20 |
- |
|
 |
American Diesel |
20-Apr-2018 16:20 |
- |
|
 |
Andrew Deutsch & Thomas Moore |
20-Apr-2018 16:20 |
- |
|
 |
Andy McGann & Paul Brady |
20-Apr-2018 16:20 |
- |
|
 |
Angeline |
20-Apr-2018 16:20 |
- |
|
 |
Anna LaCazio |
20-Apr-2018 16:20 |
- |
|
 |
Anthony Braxton Quintet |
20-Apr-2018 16:20 |
- |
|
 |
Antonín Dvořák; Prague Radio Symphony Orchestra, Vladimír Válek |
20-Apr-2018 16:20 |
- |
|
 |
Anvil of Doom |
20-Apr-2018 16:20 |
- |
|
 |
Apati |
20-Apr-2018 16:20 |
- |
|
 |
Arik Rudich |
20-Apr-2018 16:20 |
- |
|
 |
Assimilation |
20-Apr-2018 16:20 |
- |
|
 |
Beethoven; San Francisco Symphony, Michael Tilson Thomas, Emanuel Ax |
20-Apr-2018 16:20 |
- |
|
 |
Ben Thornewill |
20-Apr-2018 16:20 |
- |
|
 |
Bernard Duguay |
20-Apr-2018 16:20 |
- |
|
 |
Big Top Circus Band ⁄ Herbie Head |
20-Apr-2018 16:20 |
- |
|
 |
Bill Bruford ⁄ Michiel Borstlap |
20-Apr-2018 16:20 |
- |
|
 |
Birddie Goonatic |
20-Apr-2018 16:20 |
- |
|
 |
Birth |
20-Apr-2018 16:20 |
- |
|
 |
Blitzkrieg (Blitz) |
20-Apr-2018 16:20 |
- |
|
 |
Blood Tears |
20-Apr-2018 16:20 |
- |
|
 |
Blue Sky Archives |
20-Apr-2018 16:20 |
- |
|
 |
Bob O'Clock |
20-Apr-2018 16:20 |
- |
|
 |
Bonnie St. Claire & Unit Gloria |
20-Apr-2018 16:20 |
- |
|
 |
Boris |
20-Apr-2018 16:20 |
- |
|
 |
Brian Setzer with special guest Gary Setzer |
20-Apr-2018 16:20 |
- |
|
 |
Brighter Death Now |
20-Apr-2018 16:20 |
- |
|
 |
Brooke Allison |
20-Apr-2018 16:20 |
- |
|
 |
Butterflies On Strings |
20-Apr-2018 16:20 |
- |
|
 |
CH Straatmann |
20-Apr-2018 16:20 |
- |
|
 |
Café Jacques |
20-Apr-2018 16:20 |
- |
|
 |
Charlie Lucas Band |
20-Apr-2018 16:20 |
- |
|
 |
Chemical Synthesis |
20-Apr-2018 16:20 |
- |
|
 |
Chris Potter Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Christian Bland & The Revelators |
20-Apr-2018 16:20 |
- |
|
 |
Circus of Damnation |
20-Apr-2018 16:20 |
- |
|
 |
Collie ⁄⁄⁄⁄ Electric |
20-Apr-2018 16:20 |
- |
|
 |
Cool John Ferguson |
20-Apr-2018 16:20 |
- |
|
 |
Crucifix |
20-Apr-2018 16:20 |
- |
|
 |
DANCE☆MAN |
20-Apr-2018 16:20 |
- |
|
 |
DJ Clubstar |
20-Apr-2018 16:20 |
- |
|
 |
DOLL$BOXX |
20-Apr-2018 16:20 |
- |
|
 |
Daniel B. Prothèse |
20-Apr-2018 16:20 |
- |
|
 |
Deadsy |
20-Apr-2018 16:20 |
- |
|
 |
Death On⁄Off |
20-Apr-2018 16:20 |
- |
|
 |
Death Tothe |
20-Apr-2018 16:20 |
- |
|
 |
Delius, Elgar; Villiers Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Delta Funktionen |
20-Apr-2018 16:20 |
- |
|
 |
Dexter |
20-Apr-2018 16:20 |
- |
|
 |
Diane Jarvi |
20-Apr-2018 16:20 |
- |
|
 |
Die Alten Böcke |
20-Apr-2018 16:20 |
- |
|
 |
Dig (Directions in Groove) |
20-Apr-2018 16:20 |
- |
|
 |
Dog Eat Dog |
20-Apr-2018 16:20 |
- |
|
 |
Doug Supernaw |
20-Apr-2018 16:20 |
- |
|
 |
Dragonbound |
20-Apr-2018 16:20 |
- |
|
 |
Dreadful Children |
20-Apr-2018 16:20 |
- |
|
 |
Driven to the Verge |
20-Apr-2018 16:20 |
- |
|
 |
Eden Circus |
20-Apr-2018 16:20 |
- |
|
 |
Eduardo Lages |
20-Apr-2018 16:20 |
- |
|
 |
Elizabeth Fraser |
20-Apr-2018 16:20 |
- |
|
 |
Elusive |
20-Apr-2018 16:20 |
- |
|
 |
Emmanuel Brun |
20-Apr-2018 16:20 |
- |
|
 |
Enrico Intra |
20-Apr-2018 16:20 |
- |
|
 |
Enter VI |
20-Apr-2018 16:20 |
- |
|
 |
Expressway Yo-Yo Dieting |
20-Apr-2018 16:20 |
- |
|
 |
FATHR^ |
20-Apr-2018 16:20 |
- |
|
 |
FDISK |
20-Apr-2018 16:20 |
- |
|
 |
Fady One |
20-Apr-2018 16:20 |
- |
|
 |
Farfield |
20-Apr-2018 16:20 |
- |
|
 |
Flowers in the Dustbin |
20-Apr-2018 16:20 |
- |
|
 |
Forrest Avery & Eric Andrew |
20-Apr-2018 16:20 |
- |
|
 |
Fourth of July |
20-Apr-2018 16:20 |
- |
|
 |
Freakwater |
20-Apr-2018 16:20 |
- |
|
 |
Frenic |
20-Apr-2018 16:20 |
- |
|
 |
Gangstar Beat |
20-Apr-2018 16:20 |
- |
|
 |
Gasp |
20-Apr-2018 16:20 |
- |
|
 |
Gebroeders Brouwer |
20-Apr-2018 16:20 |
- |
|
 |
Goat Vulva |
20-Apr-2018 16:20 |
- |
|
 |
Grant |
20-Apr-2018 16:20 |
- |
|
 |
Guitarthing |
20-Apr-2018 16:20 |
- |
|
 |
Her Fatal Flaw |
20-Apr-2018 16:20 |
- |
|
 |
Hey Romeo |
20-Apr-2018 16:20 |
- |
|
 |
Hotel Bossa Nova |
20-Apr-2018 16:20 |
- |
|
 |
Ian Martin |
20-Apr-2018 16:20 |
- |
|
 |
Incendio |
20-Apr-2018 16:20 |
- |
|
 |
Ivo Deutschmann |
20-Apr-2018 16:20 |
- |
|
 |
J.R.R. Tolkien read by J.R.R. Tolkien and Christopher Tolkien |
20-Apr-2018 16:20 |
- |
|
 |
Jack Purvis and His Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Janáček, Martinů; Emerson String Quartet |
20-Apr-2018 16:20 |
- |
|
 |
Jason Corder |
20-Apr-2018 16:20 |
- |
|
 |
Jedi Knights |
20-Apr-2018 16:20 |
- |
|
 |
Jennifer Lopez featuring LL Cool J |
20-Apr-2018 16:20 |
- |
|
 |
Jesse & Joy |
20-Apr-2018 16:20 |
- |
|
 |
Joanna Rzyczniok |
20-Apr-2018 16:20 |
- |
|
 |
Johann Sebastian Bach, George Frideric Handel, Alessandro Marcello: John Williams |
20-Apr-2018 16:20 |
- |
|
 |
Johann Sebastian Bach; Choir of King’s College, Cambridge, Stephen Cleobury, James Gilchrist, Neal Davies,Academy of Ancient Music |
20-Apr-2018 16:20 |
- |
|
 |
John ME |
20-Apr-2018 16:20 |
- |
|
 |
Judy Collins & Ernie Troost |
20-Apr-2018 16:20 |
- |
|
 |
Kamisshake |
20-Apr-2018 16:20 |
- |
|
 |
Kaori Ohkoshi, Hiroshi Usami, Michio Okamiya |
20-Apr-2018 16:20 |
- |
|
 |
Karan Casey & Friends |
20-Apr-2018 16:20 |
- |
|
 |
Kate Royal,Academy of St Martin in the Fields,Edward Gardner |
20-Apr-2018 16:20 |
- |
|
 |
Kazumoto Endo ⁄ Crack Fierce |
20-Apr-2018 16:20 |
- |
|
 |
Keak da Sneak Presents A-One & Lil Rue |
20-Apr-2018 16:20 |
- |
|
 |
Kebacid |
20-Apr-2018 16:20 |
- |
|
 |
Kelan Phil Cohran and Legacy |
20-Apr-2018 16:20 |
- |
|
 |
Ken Ishii |
20-Apr-2018 16:20 |
- |
|
 |
Kerrie Roberts |
20-Apr-2018 16:20 |
- |
|
 |
Kovlo |
20-Apr-2018 16:20 |
- |
|
 |
Krs. |
20-Apr-2018 16:20 |
- |
|
 |
Kylie & Thomas Grayston |
20-Apr-2018 16:20 |
- |
|
 |
LA Riots |
20-Apr-2018 16:20 |
- |
|
 |
Lazybone |
20-Apr-2018 16:20 |
- |
|
 |
Lina Allemano Four |
20-Apr-2018 16:20 |
- |
|
 |
Long Desert Cowboy |
20-Apr-2018 16:20 |
- |
|
 |
Los Del Sur |
20-Apr-2018 16:20 |
- |
|
 |
Los Tones |
20-Apr-2018 16:20 |
- |
|
 |
Loudspeaker |
20-Apr-2018 16:20 |
- |
|
 |
Lovecraft's Adjectives |
20-Apr-2018 16:20 |
- |
|
 |
Lovedrug |
20-Apr-2018 16:20 |
- |
|
 |
Lucien Johnson |
20-Apr-2018 16:20 |
- |
|
 |
Lucius Banda and the Zembani Band |
20-Apr-2018 16:20 |
- |
|
 |
Ludwig van Beethoven; Josef Krips, London Symphony Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Major Maker |
20-Apr-2018 16:20 |
- |
|
 |
Marie Hines |
20-Apr-2018 16:20 |
- |
|
 |
Mark John Hariman |
20-Apr-2018 16:20 |
- |
|
 |
Markey |
20-Apr-2018 16:20 |
- |
|
 |
Mau Maus |
20-Apr-2018 16:20 |
- |
|
 |
Maurice Ravel; Minoru Nojima |
20-Apr-2018 16:20 |
- |
|
 |
Max Bruch; Antje Weithaas, NDR Radiophilharmonie, Hermann Bäumer |
20-Apr-2018 16:20 |
- |
|
 |
Max Elto |
20-Apr-2018 16:20 |
- |
|
 |
Memory Dean |
20-Apr-2018 16:20 |
- |
|
 |
Merit |
20-Apr-2018 16:20 |
- |
|
 |
Mimi Coertse |
20-Apr-2018 16:20 |
- |
|
 |
Moderately Messy |
20-Apr-2018 16:20 |
- |
|
 |
Monkey Biz |
20-Apr-2018 16:20 |
- |
|
 |
Moritz von Pein |
20-Apr-2018 16:20 |
- |
|
 |
Morte Macabre |
20-Apr-2018 16:20 |
- |
|
 |
Naastrand |
20-Apr-2018 16:20 |
- |
|
 |
Nabarlek |
20-Apr-2018 16:20 |
- |
|
 |
Nachtluft |
20-Apr-2018 16:20 |
- |
|
 |
New Composers |
20-Apr-2018 16:20 |
- |
|
 |
Nic Raine & Klassik Radio Pops |
20-Apr-2018 16:20 |
- |
|
 |
Nkisi |
20-Apr-2018 16:20 |
- |
|
 |
O'Donel Levy |
20-Apr-2018 16:20 |
- |
|
 |
Oakham School, David Woodcock |
20-Apr-2018 16:20 |
- |
|
 |
Omar Romero |
20-Apr-2018 16:20 |
- |
|
 |
Onset of Serious Problems |
20-Apr-2018 16:20 |
- |
|
 |
Oonah & Bonas |
20-Apr-2018 16:20 |
- |
|
 |
Open Road |
20-Apr-2018 16:20 |
- |
|
 |
Ouderkerk Kaffers |
20-Apr-2018 16:20 |
- |
|
 |
PALA$$ |
20-Apr-2018 16:20 |
- |
|
 |
Pablo Campos Trio |
20-Apr-2018 16:20 |
- |
|
 |
Panic DHH |
20-Apr-2018 16:20 |
- |
|
 |
Paper Trails |
20-Apr-2018 16:20 |
- |
|
 |
Pathogen |
20-Apr-2018 16:20 |
- |
|
 |
Petronel Baard |
20-Apr-2018 16:20 |
- |
|
 |
Poire_z & Phil Minton |
20-Apr-2018 16:20 |
- |
|
 |
President Gas |
20-Apr-2018 16:20 |
- |
|
 |
Quinzy |
20-Apr-2018 16:20 |
- |
|
 |
R.Alphonso Meets Mute Beat |
20-Apr-2018 16:20 |
- |
|
 |
Ra |
20-Apr-2018 16:20 |
- |
|
 |
Rage Brigade |
20-Apr-2018 16:20 |
- |
|
 |
Randall Wicomb |
20-Apr-2018 16:20 |
- |
|
 |
Rekta feat. RBX |
20-Apr-2018 16:20 |
- |
|
 |
Rev. Columbus Mann |
20-Apr-2018 16:20 |
- |
|
 |
Rich Matteson |
20-Apr-2018 16:20 |
- |
|
 |
Rina Hugo |
20-Apr-2018 16:20 |
- |
|
 |
Ritual Aesthetic |
20-Apr-2018 16:20 |
- |
|
 |
Rob Heron & The Tea Pad Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Rob Rock |
20-Apr-2018 16:20 |
- |
|
 |
Rock Master Scott & The Dynamic 3 |
20-Apr-2018 16:20 |
- |
|
 |
Ronan Browne |
20-Apr-2018 16:20 |
- |
|
 |
Rossanna Decelso |
20-Apr-2018 16:20 |
- |
|
 |
Roveena |
20-Apr-2018 16:20 |
- |
|
 |
Roy Eldridge with The Gene Krupa Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Rya |
20-Apr-2018 16:20 |
- |
|
 |
SAP BIG BAND |
20-Apr-2018 16:20 |
- |
|
 |
Sacaulait |
20-Apr-2018 16:20 |
- |
|
 |
Saint‐Saëns; Natalie Clein, BBC Scottish Symphony Orchestra, Andrew Manze |
20-Apr-2018 16:20 |
- |
|
 |
Scott Sebring |
20-Apr-2018 16:20 |
- |
|
 |
Search the City |
20-Apr-2018 16:20 |
- |
|
 |
Seiva Bruta |
20-Apr-2018 16:20 |
- |
|
 |
Serena Joy |
20-Apr-2018 16:20 |
- |
|
 |
SertOne |
20-Apr-2018 16:20 |
- |
|
 |
Seven That Spells |
20-Apr-2018 16:20 |
- |
|
 |
Shafqat Ali Khan |
20-Apr-2018 16:20 |
- |
|
 |
Simon Batten |
20-Apr-2018 16:20 |
- |
|
 |
Simon Landa |
20-Apr-2018 16:20 |
- |
|
 |
Sirkus Eliassen & Ben Kinx |
20-Apr-2018 16:20 |
- |
|
 |
Sitric |
20-Apr-2018 16:20 |
- |
|
 |
Sometime The Wolf. |
20-Apr-2018 16:20 |
- |
|
 |
Sophie & Ives |
20-Apr-2018 16:20 |
- |
|
 |
Southern Pacific |
20-Apr-2018 16:20 |
- |
|
 |
Spell |
20-Apr-2018 16:20 |
- |
|
 |
Spendel⁄Rössler⁄Goos |
20-Apr-2018 16:20 |
- |
|
 |
Stephen Scott |
20-Apr-2018 16:20 |
- |
|
 |
Stone & Snow |
20-Apr-2018 16:20 |
- |
|
 |
Stuntmasterz |
20-Apr-2018 16:20 |
- |
|
 |
Sumerian Droids |
20-Apr-2018 16:20 |
- |
|
 |
Supergroove Records |
20-Apr-2018 16:20 |
- |
|
 |
Sweet Lizard Illtet |
20-Apr-2018 16:20 |
- |
|
 |
Sycophant |
20-Apr-2018 16:20 |
- |
|
 |
Sylvia 55 |
20-Apr-2018 16:20 |
- |
|
 |
Szakcsi |
20-Apr-2018 16:20 |
- |
|
 |
The Blue Boy |
20-Apr-2018 16:20 |
- |
|
 |
The Children of St Mary's Primary School |
20-Apr-2018 16:20 |
- |
|
 |
The Citizens |
20-Apr-2018 16:20 |
- |
|
 |
The Drastics |
20-Apr-2018 16:20 |
- |
|
 |
The Flood |
20-Apr-2018 16:20 |
- |
|
 |
The Fureys & Davey Arthur |
20-Apr-2018 16:20 |
- |
|
 |
The Humans |
20-Apr-2018 16:20 |
- |
|
 |
The Living Souls |
20-Apr-2018 16:20 |
- |
|
 |
The Nothing |
20-Apr-2018 16:20 |
- |
|
 |
The Phantoms |
20-Apr-2018 16:20 |
- |
|
 |
The Rotten Duck |
20-Apr-2018 16:20 |
- |
|
 |
The Stattmatratzen |
20-Apr-2018 16:20 |
- |
|
 |
The Teddybears |
20-Apr-2018 16:20 |
- |
|
 |
Tim Dinkins |
20-Apr-2018 16:20 |
- |
|
 |
Tinchy Stryder feat. N-Dubz |
20-Apr-2018 16:20 |
- |
|
 |
Tiësto feat.BT |
20-Apr-2018 16:20 |
- |
|
 |
Tom Wax & Jan Jacarta |
20-Apr-2018 16:20 |
- |
|
 |
Totennacht |
20-Apr-2018 16:20 |
- |
|
 |
Trickster |
20-Apr-2018 16:20 |
- |
|
 |
Ullyr |
20-Apr-2018 16:20 |
- |
|
 |
Under The Number |
20-Apr-2018 16:20 |
- |
|
 |
Wax Poetic Featuring Otto |
20-Apr-2018 16:20 |
- |
|
 |
Wayne Jackson |
20-Apr-2018 16:20 |
- |
|
 |
Worth Dying For |
20-Apr-2018 16:20 |
- |
|
 |
Yozephine |
20-Apr-2018 16:20 |
- |
|
 |
Ysgol Sul |
20-Apr-2018 16:20 |
- |
|
 |
Yukmouth & Killa Klump |
20-Apr-2018 16:20 |
- |
|
 |
Zander Zon |
20-Apr-2018 16:20 |
- |
|
 |
duumu |
20-Apr-2018 16:20 |
- |
|
 |
ex' n'hopp |
20-Apr-2018 16:20 |
- |
|
 |
fetița mea mica |
20-Apr-2018 16:20 |
- |
|
 |
pink mink |
20-Apr-2018 16:20 |
- |
|
 |
Р. В. С. Н. |
20-Apr-2018 16:20 |
- |
|
 |
ふぇのたす |
20-Apr-2018 16:20 |
- |
|
 |
太田美知彦 |
20-Apr-2018 16:20 |
- |
|
 |
宍戸留美 |
20-Apr-2018 16:20 |
- |
|
 |
熊谷幸子 |
20-Apr-2018 16:20 |
- |
|
 |
爽 |
20-Apr-2018 16:20 |
- |
|
|